C47H33Br2N3 — CID 67982869
2-[2-[2-(2,5-dibromophenyl)ethyl]-5-phenylphenyl]-4,6-bis(3-phenylphenyl)-1,3,5-triazine (PubChem CID 67982869) has the molecular formula C47H33Br2N3 and a molecular weight of 799.61 g/mol. Its IUPAC name is 2-[2-[2-(2,5-dibromophenyl)ethyl]-5-phenylphenyl]-4,6-bis(3-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[2-[2-(2,5-dibromophenyl)ethyl]-5-phenylphenyl]-4,6-bis(3-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 67982869 |
| Molecular Formula | C47H33Br2N3 |
| Molecular Weight | 799.61 g/mol |
| Exact Mass | 797.10 |
| IUPAC Name | 2-[2-[2-(2,5-dibromophenyl)ethyl]-5-phenylphenyl]-4,6-bis(3-phenylphenyl)-1,3,5-triazine |
| SMILES | Brc1ccc(Br)c(CCc2ccc(-c3ccccc3)cc2-c2nc(-c3cccc(-c4ccccc4)c3)nc(-c3cccc(-c4ccccc4)c3)n2)c1 |
| InChI | InChI=1S/C47H33Br2N3/c48-42-26-27-44(49)39(30-42)25-23-35-22-24-38(34-16-8-3-9-17-34)31-43(35)47-51-45(40-20-10-18-36(28-40)32-12-4-1-5-13-32)50-46(52-47)41-21-11-19-37(29-41)33-14-6-2-7-15-33/h1-22,24,26-31H,23,25H2 |
| InChIKey | OIXNAJGNUBSFOT-UHFFFAOYSA-N |
| XLogP | 13.18 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.61 |
| LogP ≤ 5 | 13.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |