About 2-(5-octyl-4,5-dihydro-1H-imidazol-2-yl)ethanol
2-(5-octyl-4,5-dihydro-1H-imidazol-2-yl)ethanol (PubChem CID 67982997) has the molecular formula C13H26N2O
and a molecular weight of 226.36 g/mol. Its IUPAC name is 2-(5-octyl-4,5-dihydro-1H-imidazol-2-yl)ethanol.
Molecular Properties
| Compound Name | 2-(5-octyl-4,5-dihydro-1H-imidazol-2-yl)ethanol |
| PubChem CID | 67982997 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | 2-(5-octyl-4,5-dihydro-1H-imidazol-2-yl)ethanol |
| SMILES | CCCCCCCCC1CN=C(CCO)N1 |
| InChI | InChI=1S/C13H26N2O/c1-2-3-4-5-6-7-8-12-11-14-13(15-12)9-10-16/h12,16H,2-11H2,1H3,(H,14,15) |
| InChIKey | FKNBZBCELMQTBM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-octyl-4,5-dihydro-1H-imidazol-2-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-octyl-4,5-dihydro-1H-imidazol-2-yl)ethanol?
The IUPAC name of 2-(5-octyl-4,5-dihydro-1H-imidazol-2-yl)ethanol (CID 67982997) is 2-(5-octyl-4,5-dihydro-1H-imidazol-2-yl)ethanol.
What is the SMILES notation for 2-(5-octyl-4,5-dihydro-1H-imidazol-2-yl)ethanol?
The canonical SMILES for 2-(5-octyl-4,5-dihydro-1H-imidazol-2-yl)ethanol is CCCCCCCCC1CN=C(CCO)N1.
What is the InChIKey of 2-(5-octyl-4,5-dihydro-1H-imidazol-2-yl)ethanol?
The InChIKey is FKNBZBCELMQTBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O/c1-2-3-4-5-6-7-8-12-11-14-13(15-12)9-10-16/h12,16H,2-11H2,1H3,(H,14,15).
What are the key properties of 2-(5-octyl-4,5-dihydro-1H-imidazol-2-yl)ethanol?
2-(5-octyl-4,5-dihydro-1H-imidazol-2-yl)ethanol has a molecular weight of 226.36 g/mol, XLogP of 2.49, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-octyl-4,5-dihydro-1H-imidazol-2-yl)ethanol is sourced from PubChem (CID 67982997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).