About 3-[4-(1,2-diphenylbut-1-enyl)phenoxy]-1-propylazetidine
3-[4-(1,2-diphenylbut-1-enyl)phenoxy]-1-propylazetidine (PubChem CID 67983032) has the molecular formula C28H31NO
and a molecular weight of 397.56 g/mol. Its IUPAC name is 3-[4-(1,2-diphenylbut-1-enyl)phenoxy]-1-propylazetidine.
Molecular Properties
| Compound Name | 3-[4-(1,2-diphenylbut-1-enyl)phenoxy]-1-propylazetidine |
| PubChem CID | 67983032 |
| Molecular Formula | C28H31NO |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 3-[4-(1,2-diphenylbut-1-enyl)phenoxy]-1-propylazetidine |
| SMILES | CCCN1CC(Oc2ccc(C(=C(CC)c3ccccc3)c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C28H31NO/c1-3-19-29-20-26(21-29)30-25-17-15-24(16-18-25)28(23-13-9-6-10-14-23)27(4-2)22-11-7-5-8-12-22/h5-18,26H,3-4,19-21H2,1-2H3 |
| InChIKey | WBPNPVMMFNLBAQ-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(1,2-diphenylbut-1-enyl)phenoxy]-1-propylazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(1,2-diphenylbut-1-enyl)phenoxy]-1-propylazetidine?
The IUPAC name of 3-[4-(1,2-diphenylbut-1-enyl)phenoxy]-1-propylazetidine (CID 67983032) is 3-[4-(1,2-diphenylbut-1-enyl)phenoxy]-1-propylazetidine.
What is the SMILES notation for 3-[4-(1,2-diphenylbut-1-enyl)phenoxy]-1-propylazetidine?
The canonical SMILES for 3-[4-(1,2-diphenylbut-1-enyl)phenoxy]-1-propylazetidine is CCCN1CC(Oc2ccc(C(=C(CC)c3ccccc3)c3ccccc3)cc2)C1.
What is the InChIKey of 3-[4-(1,2-diphenylbut-1-enyl)phenoxy]-1-propylazetidine?
The InChIKey is WBPNPVMMFNLBAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H31NO/c1-3-19-29-20-26(21-29)30-25-17-15-24(16-18-25)28(23-13-9-6-10-14-23)27(4-2)22-11-7-5-8-12-22/h5-18,26H,3-4,19-21H2,1-2H3.
What are the key properties of 3-[4-(1,2-diphenylbut-1-enyl)phenoxy]-1-propylazetidine?
3-[4-(1,2-diphenylbut-1-enyl)phenoxy]-1-propylazetidine has a molecular weight of 397.56 g/mol, XLogP of 6.53, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(1,2-diphenylbut-1-enyl)phenoxy]-1-propylazetidine is sourced from PubChem (CID 67983032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).