C45H39F2N5O3 — CID 67983110
N-[3-(2,5-difluorophenoxy)-3-(hydroxymethyl)piperidin-1-yl]-3-(2-methyl-4-pyridinyl)-1-tritylindazole-5-carboxamide (PubChem CID 67983110) has the molecular formula C45H39F2N5O3 and a molecular weight of 735.84 g/mol. Its IUPAC name is N-[3-(2,5-difluorophenoxy)-3-(hydroxymethyl)piperidin-1-yl]-3-(2-methyl-4-pyridinyl)-1-tritylindazole-5-carboxamide.
| Compound Name | N-[3-(2,5-difluorophenoxy)-3-(hydroxymethyl)piperidin-1-yl]-3-(2-methyl-4-pyridinyl)-1-tritylindazole-5-carboxamide |
|---|---|
| PubChem CID | 67983110 |
| Molecular Formula | C45H39F2N5O3 |
| Molecular Weight | 735.84 g/mol |
| Exact Mass | 735.30 |
| IUPAC Name | N-[3-(2,5-difluorophenoxy)-3-(hydroxymethyl)piperidin-1-yl]-3-(2-methyl-4-pyridinyl)-1-tritylindazole-5-carboxamide |
| SMILES | Cc1cc(-c2nn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c3ccc(C(=O)NN4CCCC(CO)(Oc5cc(F)ccc5F)C4)cc23)ccn1 |
| InChI | InChI=1S/C45H39F2N5O3/c1-31-26-32(22-24-48-31)42-38-27-33(43(54)50-51-25-11-23-44(29-51,30-53)55-41-28-37(46)19-20-39(41)47)18-21-40(38)52(49-42)45(34-12-5-2-6-13-34,35-14-7-3-8-15-35)36-16-9-4-10-17-36/h2-10,12-22,24,26-28,53H,11,23,25,29-30H2,1H3,(H,50,54) |
| InChIKey | NQUQTZTZPSKDRC-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.84 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|