C34H26F3N7O3S — CID 67983120
(Z)-N-(2-aminophenyl)-3-[3-[[2-methyl-5-[6-[2-(trifluoromethyl)-3-pyridinyl]imidazo[1,2-b]pyridazin-2-yl]phenyl]sulfamoyl]phenyl]prop-2-enamide (PubChem CID 67983120) has the molecular formula C34H26F3N7O3S and a molecular weight of 669.69 g/mol. Its IUPAC name is (Z)-N-(2-aminophenyl)-3-[3-[[2-methyl-5-[6-[2-(trifluoromethyl)-3-pyridinyl]imidazo[1,2-b]pyridazin-2-yl]phenyl]sulfamoyl]phenyl]prop-2-enamide.
| Compound Name | (Z)-N-(2-aminophenyl)-3-[3-[[2-methyl-5-[6-[2-(trifluoromethyl)-3-pyridinyl]imidazo[1,2-b]pyridazin-2-yl]phenyl]sulfamoyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 67983120 |
| Molecular Formula | C34H26F3N7O3S |
| Molecular Weight | 669.69 g/mol |
| Exact Mass | 669.18 |
| IUPAC Name | (Z)-N-(2-aminophenyl)-3-[3-[[2-methyl-5-[6-[2-(trifluoromethyl)-3-pyridinyl]imidazo[1,2-b]pyridazin-2-yl]phenyl]sulfamoyl]phenyl]prop-2-enamide |
| SMILES | Cc1ccc(-c2cn3nc(-c4cccnc4C(F)(F)F)ccc3n2)cc1NS(=O)(=O)c1cccc(/C=C\C(=O)Nc2ccccc2N)c1 |
| InChI | InChI=1S/C34H26F3N7O3S/c1-21-11-13-23(30-20-44-31(40-30)15-14-27(42-44)25-8-5-17-39-33(25)34(35,36)37)19-29(21)43-48(46,47)24-7-4-6-22(18-24)12-16-32(45)41-28-10-3-2-9-26(28)38/h2-20,43H,38H2,1H3,(H,41,45)/b16-12- |
| InChIKey | XVCOFSCYNADDES-VBKFSLOCSA-N |
| XLogP | 6.82 |
| TPSA | 144.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.69 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|