C10H13ClN2O2 — CID 67983809
5-chloro-1,2,3,4-tetrahydroisoquinoline-1-carboxamide;hydrate (PubChem CID 67983809) has the molecular formula C10H13ClN2O2 and a molecular weight of 228.68 g/mol. Its IUPAC name is 5-chloro-1,2,3,4-tetrahydroisoquinoline-1-carboxamide;hydrate.
| Compound Name | 5-chloro-1,2,3,4-tetrahydroisoquinoline-1-carboxamide;hydrate |
|---|---|
| PubChem CID | 67983809 |
| Molecular Formula | C10H13ClN2O2 |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 5-chloro-1,2,3,4-tetrahydroisoquinoline-1-carboxamide;hydrate |
| SMILES | NC(=O)C1NCCc2c(Cl)cccc21.O |
| InChI | InChI=1S/C10H11ClN2O.H2O/c11-8-3-1-2-7-6(8)4-5-13-9(7)10(12)14;/h1-3,9,13H,4-5H2,(H2,12,14);1H2 |
| InChIKey | VLVIBTVZSRZWIT-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 86.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |