C26H34FN5O4 — CID 67983946
3-aminopropyl 3-[[4-[2-(diethylamino)ethylcarbamoyl]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-5-fluoro-2-oxoindole-1-carboxylate (PubChem CID 67983946) has the molecular formula C26H34FN5O4 and a molecular weight of 499.59 g/mol. Its IUPAC name is 3-aminopropyl 3-[[4-[2-(diethylamino)ethylcarbamoyl]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-5-fluoro-2-oxoindole-1-carboxylate.
| Compound Name | 3-aminopropyl 3-[[4-[2-(diethylamino)ethylcarbamoyl]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-5-fluoro-2-oxoindole-1-carboxylate |
|---|---|
| PubChem CID | 67983946 |
| Molecular Formula | C26H34FN5O4 |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | 3-aminopropyl 3-[[4-[2-(diethylamino)ethylcarbamoyl]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-5-fluoro-2-oxoindole-1-carboxylate |
| SMILES | CCN(CC)CCNC(=O)c1c(C)[nH]c(C=C2C(=O)N(C(=O)OCCCN)c3ccc(F)cc32)c1C |
| InChI | InChI=1S/C26H34FN5O4/c1-5-31(6-2)12-11-29-24(33)23-16(3)21(30-17(23)4)15-20-19-14-18(27)8-9-22(19)32(25(20)34)26(35)36-13-7-10-28/h8-9,14-15,30H,5-7,10-13,28H2,1-4H3,(H,29,33) |
| InChIKey | KOLAOUQSXCUGFJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 120.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|