About [5-[1-(trifluoromethyl)cyclopropyl]-1,2-oxazol-3-yl]carbamic acid
[5-[1-(trifluoromethyl)cyclopropyl]-1,2-oxazol-3-yl]carbamic acid (PubChem CID 67984181) has the molecular formula C8H7F3N2O3
and a molecular weight of 236.15 g/mol. Its IUPAC name is [5-[1-(trifluoromethyl)cyclopropyl]-1,2-oxazol-3-yl]carbamic acid.
Molecular Properties
| Compound Name | [5-[1-(trifluoromethyl)cyclopropyl]-1,2-oxazol-3-yl]carbamic acid |
| PubChem CID | 67984181 |
| Molecular Formula | C8H7F3N2O3 |
| Molecular Weight | 236.15 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | [5-[1-(trifluoromethyl)cyclopropyl]-1,2-oxazol-3-yl]carbamic acid |
| SMILES | O=C(O)Nc1cc(C2(C(F)(F)F)CC2)on1 |
| InChI | InChI=1S/C8H7F3N2O3/c9-8(10,11)7(1-2-7)4-3-5(13-16-4)12-6(14)15/h3H,1-2H2,(H,12,13)(H,14,15) |
| InChIKey | FLESVDHHFDDDQF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.15 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [5-[1-(trifluoromethyl)cyclopropyl]-1,2-oxazol-3-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[1-(trifluoromethyl)cyclopropyl]-1,2-oxazol-3-yl]carbamic acid?
The IUPAC name of [5-[1-(trifluoromethyl)cyclopropyl]-1,2-oxazol-3-yl]carbamic acid (CID 67984181) is [5-[1-(trifluoromethyl)cyclopropyl]-1,2-oxazol-3-yl]carbamic acid.
What is the SMILES notation for [5-[1-(trifluoromethyl)cyclopropyl]-1,2-oxazol-3-yl]carbamic acid?
The canonical SMILES for [5-[1-(trifluoromethyl)cyclopropyl]-1,2-oxazol-3-yl]carbamic acid is O=C(O)Nc1cc(C2(C(F)(F)F)CC2)on1.
What is the InChIKey of [5-[1-(trifluoromethyl)cyclopropyl]-1,2-oxazol-3-yl]carbamic acid?
The InChIKey is FLESVDHHFDDDQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F3N2O3/c9-8(10,11)7(1-2-7)4-3-5(13-16-4)12-6(14)15/h3H,1-2H2,(H,12,13)(H,14,15).
What are the key properties of [5-[1-(trifluoromethyl)cyclopropyl]-1,2-oxazol-3-yl]carbamic acid?
[5-[1-(trifluoromethyl)cyclopropyl]-1,2-oxazol-3-yl]carbamic acid has a molecular weight of 236.15 g/mol, XLogP of 2.36, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[1-(trifluoromethyl)cyclopropyl]-1,2-oxazol-3-yl]carbamic acid is sourced from PubChem (CID 67984181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).