C19H24ClN3O5S — CID 67984229
2-chloro-N-[4-ethoxy-3-(1,2,3,4-tetrahydroisoquinolin-5-ylsulfamoyl)phenyl]acetamide;hydrate (PubChem CID 67984229) has the molecular formula C19H24ClN3O5S and a molecular weight of 441.94 g/mol. Its IUPAC name is 2-chloro-N-[4-ethoxy-3-(1,2,3,4-tetrahydroisoquinolin-5-ylsulfamoyl)phenyl]acetamide;hydrate.
| Compound Name | 2-chloro-N-[4-ethoxy-3-(1,2,3,4-tetrahydroisoquinolin-5-ylsulfamoyl)phenyl]acetamide;hydrate |
|---|---|
| PubChem CID | 67984229 |
| Molecular Formula | C19H24ClN3O5S |
| Molecular Weight | 441.94 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 2-chloro-N-[4-ethoxy-3-(1,2,3,4-tetrahydroisoquinolin-5-ylsulfamoyl)phenyl]acetamide;hydrate |
| SMILES | CCOc1ccc(NC(=O)CCl)cc1S(=O)(=O)Nc1cccc2c1CCNC2.O |
| InChI | InChI=1S/C19H22ClN3O4S.H2O/c1-2-27-17-7-6-14(22-19(24)11-20)10-18(17)28(25,26)23-16-5-3-4-13-12-21-9-8-15(13)16;/h3-7,10,21,23H,2,8-9,11-12H2,1H3,(H,22,24);1H2 |
| InChIKey | HRXUGOMNMYYJLH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.94 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|