C59H37N9 — CID 67984341
2-[3,5-bis(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-4,6-dinaphthalen-2-yl-1,3,5-triazine (PubChem CID 67984341) has the molecular formula C59H37N9 and a molecular weight of 872.01 g/mol. Its IUPAC name is 2-[3,5-bis(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-4,6-dinaphthalen-2-yl-1,3,5-triazine.
| Compound Name | 2-[3,5-bis(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-4,6-dinaphthalen-2-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 67984341 |
| Molecular Formula | C59H37N9 |
| Molecular Weight | 872.01 g/mol |
| Exact Mass | 871.32 |
| IUPAC Name | 2-[3,5-bis(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-4,6-dinaphthalen-2-yl-1,3,5-triazine |
| SMILES | c1ccc(-c2cc(-c3cc(-c4cc(-c5ccccn5)nc(-c5ccccn5)c4)cc(-c4nc(-c5ccc6ccccc6c5)nc(-c5ccc6ccccc6c5)n4)c3)cc(-c3ccccn3)n2)nc1 |
| InChI | InChI=1S/C59H37N9/c1-3-15-40-29-42(23-21-38(40)13-1)57-66-58(43-24-22-39-14-2-4-16-41(39)30-43)68-59(67-57)48-32-44(46-34-53(49-17-5-9-25-60-49)64-54(35-46)50-18-6-10-26-61-50)31-45(33-48)47-36-55(51-19-7-11-27-62-51)65-56(37-47)52-20-8-12-28-63-52/h1-37H |
| InChIKey | LTEJRTDHEOFXAX-UHFFFAOYSA-N |
| XLogP | 13.55 |
| TPSA | 116.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.01 |
| LogP ≤ 5 | 13.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |