C16H18N4O2S2 — CID 67984398
5-methyl-N-(1,2,3,4-tetrahydroisoquinolin-5-yl)-2H-[1,2,5]thiadiazolo[2,3-a]pyridine-4-sulfonamide (PubChem CID 67984398) has the molecular formula C16H18N4O2S2 and a molecular weight of 362.48 g/mol. Its IUPAC name is 5-methyl-N-(1,2,3,4-tetrahydroisoquinolin-5-yl)-2H-[1,2,5]thiadiazolo[2,3-a]pyridine-4-sulfonamide.
| Compound Name | 5-methyl-N-(1,2,3,4-tetrahydroisoquinolin-5-yl)-2H-[1,2,5]thiadiazolo[2,3-a]pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 67984398 |
| Molecular Formula | C16H18N4O2S2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 5-methyl-N-(1,2,3,4-tetrahydroisoquinolin-5-yl)-2H-[1,2,5]thiadiazolo[2,3-a]pyridine-4-sulfonamide |
| SMILES | CC1=C(S(=O)(=O)Nc2cccc3c2CCNC3)C2=CNSN2C=C1 |
| InChI | InChI=1S/C16H18N4O2S2/c1-11-6-8-20-15(10-18-23-20)16(11)24(21,22)19-14-4-2-3-12-9-17-7-5-13(12)14/h2-4,6,8,10,17-19H,5,7,9H2,1H3 |
| InChIKey | IGXULGGJKULDPL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|