C15H15ClN4O3S — CID 67984526
7-chloro-N-(1,2,3,4-tetrahydroisoquinolin-6-yl)-2H-[1,2,5]oxadiazolo[2,3-a]pyridine-4-sulfonamide (PubChem CID 67984526) has the molecular formula C15H15ClN4O3S and a molecular weight of 366.83 g/mol. Its IUPAC name is 7-chloro-N-(1,2,3,4-tetrahydroisoquinolin-6-yl)-2H-[1,2,5]oxadiazolo[2,3-a]pyridine-4-sulfonamide.
| Compound Name | 7-chloro-N-(1,2,3,4-tetrahydroisoquinolin-6-yl)-2H-[1,2,5]oxadiazolo[2,3-a]pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 67984526 |
| Molecular Formula | C15H15ClN4O3S |
| Molecular Weight | 366.83 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 7-chloro-N-(1,2,3,4-tetrahydroisoquinolin-6-yl)-2H-[1,2,5]oxadiazolo[2,3-a]pyridine-4-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc2c(c1)CCNC2)C1=CC=C(Cl)N2ONC=C12 |
| InChI | InChI=1S/C15H15ClN4O3S/c16-15-4-3-14(13-9-18-23-20(13)15)24(21,22)19-12-2-1-11-8-17-6-5-10(11)7-12/h1-4,7,9,17-19H,5-6,8H2 |
| InChIKey | OVNOZPNUXGCJOL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.83 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|