C34H41Cl2N3O3 — CID 67984531
N-cyclopropyl-4-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]-2-methylanilino]-N-[(2,3-dimethylphenyl)methyl]piperidine-3-carboxamide (PubChem CID 67984531) has the molecular formula C34H41Cl2N3O3 and a molecular weight of 610.63 g/mol. Its IUPAC name is N-cyclopropyl-4-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]-2-methylanilino]-N-[(2,3-dimethylphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | N-cyclopropyl-4-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]-2-methylanilino]-N-[(2,3-dimethylphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 67984531 |
| Molecular Formula | C34H41Cl2N3O3 |
| Molecular Weight | 610.63 g/mol |
| Exact Mass | 609.25 |
| IUPAC Name | N-cyclopropyl-4-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]-2-methylanilino]-N-[(2,3-dimethylphenyl)methyl]piperidine-3-carboxamide |
| SMILES | Cc1cc(Cl)c(OCCOc2ccc(NC3CCNCC3C(=O)N(Cc3cccc(C)c3C)C3CC3)c(C)c2)c(Cl)c1 |
| InChI | InChI=1S/C34H41Cl2N3O3/c1-21-16-29(35)33(30(36)17-21)42-15-14-41-27-10-11-31(23(3)18-27)38-32-12-13-37-19-28(32)34(40)39(26-8-9-26)20-25-7-5-6-22(2)24(25)4/h5-7,10-11,16-18,26,28,32,37-38H,8-9,12-15,19-20H2,1-4H3 |
| InChIKey | NYHZGERLICDEMC-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.63 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|