C15H13BN2O5S — CID 67984541
3-(1,3-benzoxazol-4-yl)-2-(1,3,2-dioxaborolan-2-yl)benzenesulfonamide (PubChem CID 67984541) has the molecular formula C15H13BN2O5S and a molecular weight of 344.16 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-4-yl)-2-(1,3,2-dioxaborolan-2-yl)benzenesulfonamide.
| Compound Name | 3-(1,3-benzoxazol-4-yl)-2-(1,3,2-dioxaborolan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 67984541 |
| Molecular Formula | C15H13BN2O5S |
| Molecular Weight | 344.16 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 3-(1,3-benzoxazol-4-yl)-2-(1,3,2-dioxaborolan-2-yl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(-c2cccc3ocnc23)c1B1OCCO1 |
| InChI | InChI=1S/C15H13BN2O5S/c17-24(19,20)13-6-2-3-10(14(13)16-22-7-8-23-16)11-4-1-5-12-15(11)18-9-21-12/h1-6,9H,7-8H2,(H2,17,19,20) |
| InChIKey | VVQOJPHMDCIUCU-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.16 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|