C32H33N3O3 — CID 67985071
5-[7-[[(1R)-4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl]carbamoyl]-3-phenylquinoxalin-2-yl]pentanoic acid (PubChem CID 67985071) has the molecular formula C32H33N3O3 and a molecular weight of 507.63 g/mol. Its IUPAC name is 5-[7-[[(1R)-4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl]carbamoyl]-3-phenylquinoxalin-2-yl]pentanoic acid.
| Compound Name | 5-[7-[[(1R)-4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl]carbamoyl]-3-phenylquinoxalin-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 67985071 |
| Molecular Formula | C32H33N3O3 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | 5-[7-[[(1R)-4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl]carbamoyl]-3-phenylquinoxalin-2-yl]pentanoic acid |
| SMILES | CC1(C)CC[C@@H](NC(=O)c2ccc3nc(-c4ccccc4)c(CCCCC(=O)O)nc3c2)c2ccccc21 |
| InChI | InChI=1S/C32H33N3O3/c1-32(2)19-18-25(23-12-6-7-13-24(23)32)35-31(38)22-16-17-26-28(20-22)33-27(14-8-9-15-29(36)37)30(34-26)21-10-4-3-5-11-21/h3-7,10-13,16-17,20,25H,8-9,14-15,18-19H2,1-2H3,(H,35,38)(H,36,37)/t25-/m1/s1 |
| InChIKey | VRIZCYFJZIFCAH-RUZDIDTESA-N |
| XLogP | 6.64 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|