C15H28O4Si — CID 67985347
[(1S,2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-3-methylidenecyclopentyl] acetate (PubChem CID 67985347) has the molecular formula C15H28O4Si and a molecular weight of 300.47 g/mol. Its IUPAC name is [(1S,2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-3-methylidenecyclopentyl] acetate.
| Compound Name | [(1S,2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-3-methylidenecyclopentyl] acetate |
|---|---|
| PubChem CID | 67985347 |
| Molecular Formula | C15H28O4Si |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | [(1S,2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-3-methylidenecyclopentyl] acetate |
| SMILES | C=C1[C@H](O[Si](C)(C)C(C)(C)C)C[C@H](OC(C)=O)[C@H]1CO |
| InChI | InChI=1S/C15H28O4Si/c1-10-12(9-16)14(18-11(2)17)8-13(10)19-20(6,7)15(3,4)5/h12-14,16H,1,8-9H2,2-7H3/t12-,13+,14-/m0/s1 |
| InChIKey | PLLNSPHODRWWNO-MJBXVCDLSA-N |
| XLogP | 2.88 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|