C31H33ClFN3O4 — CID 67986060
(4-fluorophenyl) 6-chloro-1-[3-[3-[2-methoxyethyl(methyl)amino]propoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 67986060) has the molecular formula C31H33ClFN3O4 and a molecular weight of 566.07 g/mol. Its IUPAC name is (4-fluorophenyl) 6-chloro-1-[3-[3-[2-methoxyethyl(methyl)amino]propoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-fluorophenyl) 6-chloro-1-[3-[3-[2-methoxyethyl(methyl)amino]propoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 67986060 |
| Molecular Formula | C31H33ClFN3O4 |
| Molecular Weight | 566.07 g/mol |
| Exact Mass | 565.21 |
| IUPAC Name | (4-fluorophenyl) 6-chloro-1-[3-[3-[2-methoxyethyl(methyl)amino]propoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | COCCN(C)CCCOc1cccc(C2c3[nH]c4ccc(Cl)cc4c3CCN2C(=O)Oc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C31H33ClFN3O4/c1-35(16-18-38-2)14-4-17-39-25-6-3-5-21(19-25)30-29-26(27-20-22(32)7-12-28(27)34-29)13-15-36(30)31(37)40-24-10-8-23(33)9-11-24/h3,5-12,19-20,30,34H,4,13-18H2,1-2H3 |
| InChIKey | GITXELQDBRZXMU-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 67.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.07 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|