C29H25ClFN5O3 — CID 67986065
(4-fluorophenyl) 6-chloro-1-[3-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 67986065) has the molecular formula C29H25ClFN5O3 and a molecular weight of 546.00 g/mol. Its IUPAC name is (4-fluorophenyl) 6-chloro-1-[3-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-fluorophenyl) 6-chloro-1-[3-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 67986065 |
| Molecular Formula | C29H25ClFN5O3 |
| Molecular Weight | 546.00 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | (4-fluorophenyl) 6-chloro-1-[3-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | O=C(Oc1ccc(F)cc1)N1CCc2c([nH]c3ccc(Cl)cc23)C1c1cccc(OCCCn2cncn2)c1 |
| InChI | InChI=1S/C29H25ClFN5O3/c30-20-5-10-26-25(16-20)24-11-13-36(29(37)39-22-8-6-21(31)7-9-22)28(27(24)34-26)19-3-1-4-23(15-19)38-14-2-12-35-18-32-17-33-35/h1,3-10,15-18,28,34H,2,11-14H2 |
| InChIKey | MIHXEQYTOYWNDM-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 85.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.00 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|