C17H23Cl2N3O — CID 67986272
3-(3,5-dichloroanilino)-1-[(3R,4S)-4-methylpiperidin-3-yl]piperidin-2-one (PubChem CID 67986272) has the molecular formula C17H23Cl2N3O and a molecular weight of 356.30 g/mol. Its IUPAC name is 3-(3,5-dichloroanilino)-1-[(3R,4S)-4-methylpiperidin-3-yl]piperidin-2-one.
| Compound Name | 3-(3,5-dichloroanilino)-1-[(3R,4S)-4-methylpiperidin-3-yl]piperidin-2-one |
|---|---|
| PubChem CID | 67986272 |
| Molecular Formula | C17H23Cl2N3O |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 3-(3,5-dichloroanilino)-1-[(3R,4S)-4-methylpiperidin-3-yl]piperidin-2-one |
| SMILES | C[C@H]1CCNC[C@@H]1N1CCCC(Nc2cc(Cl)cc(Cl)c2)C1=O |
| InChI | InChI=1S/C17H23Cl2N3O/c1-11-4-5-20-10-16(11)22-6-2-3-15(17(22)23)21-14-8-12(18)7-13(19)9-14/h7-9,11,15-16,20-21H,2-6,10H2,1H3/t11-,15?,16-/m0/s1 |
| InChIKey | VWQVGWZPOPJJPK-RMZCCROUSA-N |
| XLogP | 3.39 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |