C25H26N6O — CID 67986384
1-benzyl-3-[3-[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-3-yl]phenyl]urea (PubChem CID 67986384) has the molecular formula C25H26N6O and a molecular weight of 426.52 g/mol. Its IUPAC name is 1-benzyl-3-[3-[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-3-yl]phenyl]urea.
| Compound Name | 1-benzyl-3-[3-[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-3-yl]phenyl]urea |
|---|---|
| PubChem CID | 67986384 |
| Molecular Formula | C25H26N6O |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 1-benzyl-3-[3-[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-3-yl]phenyl]urea |
| SMILES | O=C(NCc1ccccc1)Nc1cccc(C2CCCN(c3ncnc4[nH]ccc34)C2)c1 |
| InChI | InChI=1S/C25H26N6O/c32-25(27-15-18-6-2-1-3-7-18)30-21-10-4-8-19(14-21)20-9-5-13-31(16-20)24-22-11-12-26-23(22)28-17-29-24/h1-4,6-8,10-12,14,17,20H,5,9,13,15-16H2,(H,26,28,29)(H2,27,30,32) |
| InChIKey | XKIIREHJCDAFNL-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |