About 2-[(1S,5R)-6-bicyclo[3.1.0]hexanyl]-4-methyl-1,3-oxazole
2-[(1S,5R)-6-bicyclo[3.1.0]hexanyl]-4-methyl-1,3-oxazole (PubChem CID 67986504) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 2-[(1S,5R)-6-bicyclo[3.1.0]hexanyl]-4-methyl-1,3-oxazole.
Molecular Properties
| Compound Name | 2-[(1S,5R)-6-bicyclo[3.1.0]hexanyl]-4-methyl-1,3-oxazole |
| PubChem CID | 67986504 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 2-[(1S,5R)-6-bicyclo[3.1.0]hexanyl]-4-methyl-1,3-oxazole |
| SMILES | Cc1coc(C2[C@H]3CCC[C@@H]23)n1 |
| InChI | InChI=1S/C10H13NO/c1-6-5-12-10(11-6)9-7-3-2-4-8(7)9/h5,7-9H,2-4H2,1H3/t7-,8+,9? |
| InChIKey | HUUXIFJVNXHEEL-JVHMLUBASA-N |
| XLogP | 2.50 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(1S,5R)-6-bicyclo[3.1.0]hexanyl]-4-methyl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S,5R)-6-bicyclo[3.1.0]hexanyl]-4-methyl-1,3-oxazole?
The IUPAC name of 2-[(1S,5R)-6-bicyclo[3.1.0]hexanyl]-4-methyl-1,3-oxazole (CID 67986504) is 2-[(1S,5R)-6-bicyclo[3.1.0]hexanyl]-4-methyl-1,3-oxazole.
What is the SMILES notation for 2-[(1S,5R)-6-bicyclo[3.1.0]hexanyl]-4-methyl-1,3-oxazole?
The canonical SMILES for 2-[(1S,5R)-6-bicyclo[3.1.0]hexanyl]-4-methyl-1,3-oxazole is Cc1coc(C2[C@H]3CCC[C@@H]23)n1.
What is the InChIKey of 2-[(1S,5R)-6-bicyclo[3.1.0]hexanyl]-4-methyl-1,3-oxazole?
The InChIKey is HUUXIFJVNXHEEL-JVHMLUBASA-N. The full InChI is InChI=1S/C10H13NO/c1-6-5-12-10(11-6)9-7-3-2-4-8(7)9/h5,7-9H,2-4H2,1H3/t7-,8+,9?.
What are the key properties of 2-[(1S,5R)-6-bicyclo[3.1.0]hexanyl]-4-methyl-1,3-oxazole?
2-[(1S,5R)-6-bicyclo[3.1.0]hexanyl]-4-methyl-1,3-oxazole has a molecular weight of 163.22 g/mol, XLogP of 2.50, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,5R)-6-bicyclo[3.1.0]hexanyl]-4-methyl-1,3-oxazole is sourced from PubChem (CID 67986504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).