About trans-(2R,4R)-2-hydroxy-4-[2-(4-phenylphenyl)propan-2-yl]cyclopentan-1-one
trans-(2R,4R)-2-hydroxy-4-[2-(4-phenylphenyl)propan-2-yl]cyclopentan-1-one (PubChem CID 67986808) has the molecular formula C20H22O2
and a molecular weight of 294.39 g/mol. Its IUPAC name is trans-(2R,4R)-2-hydroxy-4-[2-(4-phenylphenyl)propan-2-yl]cyclopentan-1-one.
Molecular Properties
| Compound Name | trans-(2R,4R)-2-hydroxy-4-[2-(4-phenylphenyl)propan-2-yl]cyclopentan-1-one |
| PubChem CID | 67986808 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | trans-(2R,4R)-2-hydroxy-4-[2-(4-phenylphenyl)propan-2-yl]cyclopentan-1-one |
| SMILES | CC(C)(c1ccc(-c2ccccc2)cc1)[C@H]1CC(=O)[C@H](O)C1 |
| InChI | InChI=1S/C20H22O2/c1-20(2,17-12-18(21)19(22)13-17)16-10-8-15(9-11-16)14-6-4-3-5-7-14/h3-11,17-18,21H,12-13H2,1-2H3/t17-,18-/m1/s1 |
| InChIKey | GXBMRTTXRLLQHR-QZTJIDSGSA-N |
| XLogP | 3.97 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze trans-(2R,4R)-2-hydroxy-4-[2-(4-phenylphenyl)propan-2-yl]cyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(2R,4R)-2-hydroxy-4-[2-(4-phenylphenyl)propan-2-yl]cyclopentan-1-one?
The IUPAC name of trans-(2R,4R)-2-hydroxy-4-[2-(4-phenylphenyl)propan-2-yl]cyclopentan-1-one (CID 67986808) is trans-(2R,4R)-2-hydroxy-4-[2-(4-phenylphenyl)propan-2-yl]cyclopentan-1-one.
What is the SMILES notation for trans-(2R,4R)-2-hydroxy-4-[2-(4-phenylphenyl)propan-2-yl]cyclopentan-1-one?
The canonical SMILES for trans-(2R,4R)-2-hydroxy-4-[2-(4-phenylphenyl)propan-2-yl]cyclopentan-1-one is CC(C)(c1ccc(-c2ccccc2)cc1)[C@H]1CC(=O)[C@H](O)C1.
What is the InChIKey of trans-(2R,4R)-2-hydroxy-4-[2-(4-phenylphenyl)propan-2-yl]cyclopentan-1-one?
The InChIKey is GXBMRTTXRLLQHR-QZTJIDSGSA-N. The full InChI is InChI=1S/C20H22O2/c1-20(2,17-12-18(21)19(22)13-17)16-10-8-15(9-11-16)14-6-4-3-5-7-14/h3-11,17-18,21H,12-13H2,1-2H3/t17-,18-/m1/s1.
What are the key properties of trans-(2R,4R)-2-hydroxy-4-[2-(4-phenylphenyl)propan-2-yl]cyclopentan-1-one?
trans-(2R,4R)-2-hydroxy-4-[2-(4-phenylphenyl)propan-2-yl]cyclopentan-1-one has a molecular weight of 294.39 g/mol, XLogP of 3.97, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(2R,4R)-2-hydroxy-4-[2-(4-phenylphenyl)propan-2-yl]cyclopentan-1-one is sourced from PubChem (CID 67986808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).