C22H25N5O — CID 67986811
4-(5-methyl-2-pyridinyl)-1-(5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-7-yl)piperazin-2-one (PubChem CID 67986811) has the molecular formula C22H25N5O and a molecular weight of 375.48 g/mol. Its IUPAC name is 4-(5-methyl-2-pyridinyl)-1-(5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-7-yl)piperazin-2-one.
| Compound Name | 4-(5-methyl-2-pyridinyl)-1-(5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-7-yl)piperazin-2-one |
|---|---|
| PubChem CID | 67986811 |
| Molecular Formula | C22H25N5O |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | 4-(5-methyl-2-pyridinyl)-1-(5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-7-yl)piperazin-2-one |
| SMILES | Cc1ccc(N2CCN(c3ccc4c5c(n(C)c4c3)CCNC5)C(=O)C2)nc1 |
| InChI | InChI=1S/C22H25N5O/c1-15-3-6-21(24-12-15)26-9-10-27(22(28)14-26)16-4-5-17-18-13-23-8-7-19(18)25(2)20(17)11-16/h3-6,11-12,23H,7-10,13-14H2,1-2H3 |
| InChIKey | UZQUIMWHHBYBGT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|