C28H28N2O5S — CID 67986914
5-[4-[[(1R)-4-[6-(2-ethoxyethoxy)-2-methyl-3-pyridinyl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1-oxo-1,2-thiazol-3-one (PubChem CID 67986914) has the molecular formula C28H28N2O5S and a molecular weight of 504.61 g/mol. Its IUPAC name is 5-[4-[[(1R)-4-[6-(2-ethoxyethoxy)-2-methyl-3-pyridinyl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1-oxo-1,2-thiazol-3-one.
| Compound Name | 5-[4-[[(1R)-4-[6-(2-ethoxyethoxy)-2-methyl-3-pyridinyl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1-oxo-1,2-thiazol-3-one |
|---|---|
| PubChem CID | 67986914 |
| Molecular Formula | C28H28N2O5S |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | 5-[4-[[(1R)-4-[6-(2-ethoxyethoxy)-2-methyl-3-pyridinyl]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1-oxo-1,2-thiazol-3-one |
| SMILES | CCOCCOc1ccc(-c2cccc3c2CC[C@H]3Oc2ccc(C3=CC(=O)NS3=O)cc2)c(C)n1 |
| InChI | InChI=1S/C28H28N2O5S/c1-3-33-15-16-34-28-14-12-21(18(2)29-28)22-5-4-6-24-23(22)11-13-25(24)35-20-9-7-19(8-10-20)26-17-27(31)30-36(26)32/h4-10,12,14,17,25H,3,11,13,15-16H2,1-2H3,(H,30,31)/t25-,36?/m1/s1 |
| InChIKey | NCUDBZOUTGVRPT-NNHKGWTCSA-N |
| XLogP | 4.67 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|