C23H17FN2O3S — CID 67986926
5-[4-[[(1R)-4-(6-fluoro-3-pyridinyl)-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1-oxo-1,2-thiazol-3-one (PubChem CID 67986926) has the molecular formula C23H17FN2O3S and a molecular weight of 420.47 g/mol. Its IUPAC name is 5-[4-[[(1R)-4-(6-fluoro-3-pyridinyl)-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1-oxo-1,2-thiazol-3-one.
| Compound Name | 5-[4-[[(1R)-4-(6-fluoro-3-pyridinyl)-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1-oxo-1,2-thiazol-3-one |
|---|---|
| PubChem CID | 67986926 |
| Molecular Formula | C23H17FN2O3S |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 5-[4-[[(1R)-4-(6-fluoro-3-pyridinyl)-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1-oxo-1,2-thiazol-3-one |
| SMILES | O=C1C=C(c2ccc(O[C@@H]3CCc4c(-c5ccc(F)nc5)cccc43)cc2)S(=O)N1 |
| InChI | InChI=1S/C23H17FN2O3S/c24-22-11-6-15(13-25-22)17-2-1-3-19-18(17)9-10-20(19)29-16-7-4-14(5-8-16)21-12-23(27)26-30(21)28/h1-8,11-13,20H,9-10H2,(H,26,27)/t20-,30?/m1/s1 |
| InChIKey | RURMXJGSGGYTNQ-UEWHNOOISA-N |
| XLogP | 4.09 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|