About 5-methoxy-N,N-dimethyl-2-phenyl-1-benzofuran-3-carboxamide
5-methoxy-N,N-dimethyl-2-phenyl-1-benzofuran-3-carboxamide (PubChem CID 679872) has the molecular formula C18H17NO3
and a molecular weight of 295.34 g/mol. Its IUPAC name is 5-methoxy-N,N-dimethyl-2-phenyl-1-benzofuran-3-carboxamide.
Molecular Properties
| Compound Name | 5-methoxy-N,N-dimethyl-2-phenyl-1-benzofuran-3-carboxamide |
| PubChem CID | 679872 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 5-methoxy-N,N-dimethyl-2-phenyl-1-benzofuran-3-carboxamide |
| SMILES | COc1ccc2oc(-c3ccccc3)c(C(=O)N(C)C)c2c1 |
| InChI | InChI=1S/C18H17NO3/c1-19(2)18(20)16-14-11-13(21-3)9-10-15(14)22-17(16)12-7-5-4-6-8-12/h4-11H,1-3H3 |
| InChIKey | CTTUDYDDUBGGSG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methoxy-N,N-dimethyl-2-phenyl-1-benzofuran-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-N,N-dimethyl-2-phenyl-1-benzofuran-3-carboxamide?
The IUPAC name of 5-methoxy-N,N-dimethyl-2-phenyl-1-benzofuran-3-carboxamide (CID 679872) is 5-methoxy-N,N-dimethyl-2-phenyl-1-benzofuran-3-carboxamide.
What is the SMILES notation for 5-methoxy-N,N-dimethyl-2-phenyl-1-benzofuran-3-carboxamide?
The canonical SMILES for 5-methoxy-N,N-dimethyl-2-phenyl-1-benzofuran-3-carboxamide is COc1ccc2oc(-c3ccccc3)c(C(=O)N(C)C)c2c1.
What is the InChIKey of 5-methoxy-N,N-dimethyl-2-phenyl-1-benzofuran-3-carboxamide?
The InChIKey is CTTUDYDDUBGGSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO3/c1-19(2)18(20)16-14-11-13(21-3)9-10-15(14)22-17(16)12-7-5-4-6-8-12/h4-11H,1-3H3.
What are the key properties of 5-methoxy-N,N-dimethyl-2-phenyl-1-benzofuran-3-carboxamide?
5-methoxy-N,N-dimethyl-2-phenyl-1-benzofuran-3-carboxamide has a molecular weight of 295.34 g/mol, XLogP of 3.81, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-N,N-dimethyl-2-phenyl-1-benzofuran-3-carboxamide is sourced from PubChem (CID 679872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).