C17H25FN6OS — CID 67988365
6-(3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-ylsulfanylmethyl)-2-N-(4-fluorocyclohexyl)-1,3,5-triazine-2,4-diamine (PubChem CID 67988365) has the molecular formula C17H25FN6OS and a molecular weight of 380.49 g/mol. Its IUPAC name is 6-(3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-ylsulfanylmethyl)-2-N-(4-fluorocyclohexyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-ylsulfanylmethyl)-2-N-(4-fluorocyclohexyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 67988365 |
| Molecular Formula | C17H25FN6OS |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 6-(3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-ylsulfanylmethyl)-2-N-(4-fluorocyclohexyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(CSC2=NC3CCCCC3O2)nc(NC2CCC(F)CC2)n1 |
| InChI | InChI=1S/C17H25FN6OS/c18-10-5-7-11(8-6-10)20-16-23-14(22-15(19)24-16)9-26-17-21-12-3-1-2-4-13(12)25-17/h10-13H,1-9H2,(H3,19,20,22,23,24) |
| InChIKey | CSRXTUBMMUEZRD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |