About 6-(2,2-dimethylpropyl)-9-methylpyrido[3,4-b]indole
6-(2,2-dimethylpropyl)-9-methylpyrido[3,4-b]indole (PubChem CID 67988444) has the molecular formula C17H20N2
and a molecular weight of 252.36 g/mol. Its IUPAC name is 6-(2,2-dimethylpropyl)-9-methylpyrido[3,4-b]indole.
Molecular Properties
| Compound Name | 6-(2,2-dimethylpropyl)-9-methylpyrido[3,4-b]indole |
| PubChem CID | 67988444 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 6-(2,2-dimethylpropyl)-9-methylpyrido[3,4-b]indole |
| SMILES | Cn1c2ccc(CC(C)(C)C)cc2c2ccncc21 |
| InChI | InChI=1S/C17H20N2/c1-17(2,3)10-12-5-6-15-14(9-12)13-7-8-18-11-16(13)19(15)4/h5-9,11H,10H2,1-4H3 |
| InChIKey | IVVBHYMLYCNQOU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(2,2-dimethylpropyl)-9-methylpyrido[3,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,2-dimethylpropyl)-9-methylpyrido[3,4-b]indole?
The IUPAC name of 6-(2,2-dimethylpropyl)-9-methylpyrido[3,4-b]indole (CID 67988444) is 6-(2,2-dimethylpropyl)-9-methylpyrido[3,4-b]indole.
What is the SMILES notation for 6-(2,2-dimethylpropyl)-9-methylpyrido[3,4-b]indole?
The canonical SMILES for 6-(2,2-dimethylpropyl)-9-methylpyrido[3,4-b]indole is Cn1c2ccc(CC(C)(C)C)cc2c2ccncc21.
What is the InChIKey of 6-(2,2-dimethylpropyl)-9-methylpyrido[3,4-b]indole?
The InChIKey is IVVBHYMLYCNQOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2/c1-17(2,3)10-12-5-6-15-14(9-12)13-7-8-18-11-16(13)19(15)4/h5-9,11H,10H2,1-4H3.
What are the key properties of 6-(2,2-dimethylpropyl)-9-methylpyrido[3,4-b]indole?
6-(2,2-dimethylpropyl)-9-methylpyrido[3,4-b]indole has a molecular weight of 252.36 g/mol, XLogP of 4.32, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,2-dimethylpropyl)-9-methylpyrido[3,4-b]indole is sourced from PubChem (CID 67988444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).