C54H50N6Si — CID 67988458
bis[12-(2,2-dimethylpropyl)-8-phenyl-6,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-4-yl]-diphenylsilane (PubChem CID 67988458) has the molecular formula C54H50N6Si and a molecular weight of 811.12 g/mol. Its IUPAC name is bis[12-(2,2-dimethylpropyl)-8-phenyl-6,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-4-yl]-diphenylsilane.
| Compound Name | bis[12-(2,2-dimethylpropyl)-8-phenyl-6,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-4-yl]-diphenylsilane |
|---|---|
| PubChem CID | 67988458 |
| Molecular Formula | C54H50N6Si |
| Molecular Weight | 811.12 g/mol |
| Exact Mass | 810.39 |
| IUPAC Name | bis[12-(2,2-dimethylpropyl)-8-phenyl-6,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-4-yl]-diphenylsilane |
| SMILES | CC(C)(C)Cc1cnc2c(c1)c1cc([Si](c3ccccc3)(c3ccccc3)c3cnc4c(c3)c3cc(CC(C)(C)C)cnc3n4-c3ccccc3)cnc1n2-c1ccccc1 |
| InChI | InChI=1S/C54H50N6Si/c1-53(2,3)31-37-27-45-47-29-43(35-57-51(47)59(49(45)55-33-37)39-19-11-7-12-20-39)61(41-23-15-9-16-24-41,42-25-17-10-18-26-42)44-30-48-46-28-38(32-54(4,5)6)34-56-50(46)60(52(48)58-36-44)40-21-13-8-14-22-40/h7-30,33-36H,31-32H2,1-6H3 |
| InChIKey | AWWLLZBKJBXRAW-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.12 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|