About 5-methyl-8-(2-methylbutan-2-yl)pyrido[3,2-b]indole
5-methyl-8-(2-methylbutan-2-yl)pyrido[3,2-b]indole (PubChem CID 67988473) has the molecular formula C17H20N2
and a molecular weight of 252.36 g/mol. Its IUPAC name is 5-methyl-8-(2-methylbutan-2-yl)pyrido[3,2-b]indole.
Molecular Properties
| Compound Name | 5-methyl-8-(2-methylbutan-2-yl)pyrido[3,2-b]indole |
| PubChem CID | 67988473 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 5-methyl-8-(2-methylbutan-2-yl)pyrido[3,2-b]indole |
| SMILES | CCC(C)(C)c1ccc2c(c1)c1ncccc1n2C |
| InChI | InChI=1S/C17H20N2/c1-5-17(2,3)12-8-9-14-13(11-12)16-15(19(14)4)7-6-10-18-16/h6-11H,5H2,1-4H3 |
| InChIKey | FIUSYEFIUPXJFV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-8-(2-methylbutan-2-yl)pyrido[3,2-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-8-(2-methylbutan-2-yl)pyrido[3,2-b]indole?
The IUPAC name of 5-methyl-8-(2-methylbutan-2-yl)pyrido[3,2-b]indole (CID 67988473) is 5-methyl-8-(2-methylbutan-2-yl)pyrido[3,2-b]indole.
What is the SMILES notation for 5-methyl-8-(2-methylbutan-2-yl)pyrido[3,2-b]indole?
The canonical SMILES for 5-methyl-8-(2-methylbutan-2-yl)pyrido[3,2-b]indole is CCC(C)(C)c1ccc2c(c1)c1ncccc1n2C.
What is the InChIKey of 5-methyl-8-(2-methylbutan-2-yl)pyrido[3,2-b]indole?
The InChIKey is FIUSYEFIUPXJFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2/c1-5-17(2,3)12-8-9-14-13(11-12)16-15(19(14)4)7-6-10-18-16/h6-11H,5H2,1-4H3.
What are the key properties of 5-methyl-8-(2-methylbutan-2-yl)pyrido[3,2-b]indole?
5-methyl-8-(2-methylbutan-2-yl)pyrido[3,2-b]indole has a molecular weight of 252.36 g/mol, XLogP of 4.41, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-8-(2-methylbutan-2-yl)pyrido[3,2-b]indole is sourced from PubChem (CID 67988473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).