C46H48N4Si — CID 67988479
bis[4-[8-(2,2-dimethylpropyl)pyrido[4,3-b]indol-5-yl]phenyl]-dimethylsilane (PubChem CID 67988479) has the molecular formula C46H48N4Si and a molecular weight of 685.00 g/mol. Its IUPAC name is bis[4-[8-(2,2-dimethylpropyl)pyrido[4,3-b]indol-5-yl]phenyl]-dimethylsilane.
| Compound Name | bis[4-[8-(2,2-dimethylpropyl)pyrido[4,3-b]indol-5-yl]phenyl]-dimethylsilane |
|---|---|
| PubChem CID | 67988479 |
| Molecular Formula | C46H48N4Si |
| Molecular Weight | 685.00 g/mol |
| Exact Mass | 684.36 |
| IUPAC Name | bis[4-[8-(2,2-dimethylpropyl)pyrido[4,3-b]indol-5-yl]phenyl]-dimethylsilane |
| SMILES | CC(C)(C)Cc1ccc2c(c1)c1cnccc1n2-c1ccc([Si](C)(C)c2ccc(-n3c4ccncc4c4cc(CC(C)(C)C)ccc43)cc2)cc1 |
| InChI | InChI=1S/C46H48N4Si/c1-45(2,3)27-31-9-19-41-37(25-31)39-29-47-23-21-43(39)49(41)33-11-15-35(16-12-33)51(7,8)36-17-13-34(14-18-36)50-42-20-10-32(28-46(4,5)6)26-38(42)40-30-48-24-22-44(40)50/h9-26,29-30H,27-28H2,1-8H3 |
| InChIKey | ZHWBAAYREXTPKI-UHFFFAOYSA-N |
| XLogP | 10.67 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.00 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|