C44H30N6Si — CID 67988486
diphenyl-bis(8-phenyl-5,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-yl)silane (PubChem CID 67988486) has the molecular formula C44H30N6Si and a molecular weight of 670.85 g/mol. Its IUPAC name is diphenyl-bis(8-phenyl-5,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-yl)silane.
| Compound Name | diphenyl-bis(8-phenyl-5,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-yl)silane |
|---|---|
| PubChem CID | 67988486 |
| Molecular Formula | C44H30N6Si |
| Molecular Weight | 670.85 g/mol |
| Exact Mass | 670.23 |
| IUPAC Name | diphenyl-bis(8-phenyl-5,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-yl)silane |
| SMILES | c1ccc(-n2c3cnccc3c3cc([Si](c4ccccc4)(c4ccccc4)c4cc5c6ccncc6n(-c6ccccc6)c5cn4)ncc32)cc1 |
| InChI | InChI=1S/C44H30N6Si/c1-5-13-31(14-6-1)49-39-27-45-23-21-35(39)37-25-43(47-29-41(37)49)51(33-17-9-3-10-18-33,34-19-11-4-12-20-34)44-26-38-36-22-24-46-28-40(36)50(42(38)30-48-44)32-15-7-2-8-16-32/h1-30H |
| InChIKey | GAGBJOKVQZSRFA-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.85 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|