C14H21N3 — CID 67988743
1-(cyclohexa-1,5-dien-1-ylmethyl)-3a,4,5,6,7,7a-hexahydrobenzimidazol-2-amine (PubChem CID 67988743) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is 1-(cyclohexa-1,5-dien-1-ylmethyl)-3a,4,5,6,7,7a-hexahydrobenzimidazol-2-amine.
| Compound Name | 1-(cyclohexa-1,5-dien-1-ylmethyl)-3a,4,5,6,7,7a-hexahydrobenzimidazol-2-amine |
|---|---|
| PubChem CID | 67988743 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 1-(cyclohexa-1,5-dien-1-ylmethyl)-3a,4,5,6,7,7a-hexahydrobenzimidazol-2-amine |
| SMILES | NC1=NC2CCCCC2N1CC1=CCCC=C1 |
| InChI | InChI=1S/C14H21N3/c15-14-16-12-8-4-5-9-13(12)17(14)10-11-6-2-1-3-7-11/h2,6-7,12-13H,1,3-5,8-10H2,(H2,15,16) |
| InChIKey | YDOUCJUFHNCHSM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |