C18H17FN4O4 — CID 67988868
(14S,15S)-8-fluoro-6-methyl-14-[(1,2-oxazol-3-ylamino)methyl]-13-oxa-6,11-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-1,7,9-triene-5,12-dione (PubChem CID 67988868) has the molecular formula C18H17FN4O4 and a molecular weight of 372.36 g/mol. Its IUPAC name is (14S,15S)-8-fluoro-6-methyl-14-[(1,2-oxazol-3-ylamino)methyl]-13-oxa-6,11-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-1,7,9-triene-5,12-dione.
| Compound Name | (14S,15S)-8-fluoro-6-methyl-14-[(1,2-oxazol-3-ylamino)methyl]-13-oxa-6,11-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-1,7,9-triene-5,12-dione |
|---|---|
| PubChem CID | 67988868 |
| Molecular Formula | C18H17FN4O4 |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | (14S,15S)-8-fluoro-6-methyl-14-[(1,2-oxazol-3-ylamino)methyl]-13-oxa-6,11-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-1,7,9-triene-5,12-dione |
| SMILES | CN1C(=O)CCc2c3c(cc(F)c21)N1C(=O)O[C@@H](CNc2ccon2)[C@@H]1C3 |
| InChI | InChI=1S/C18H17FN4O4/c1-22-16(24)3-2-9-10-6-13-14(8-20-15-4-5-26-21-15)27-18(25)23(13)12(10)7-11(19)17(9)22/h4-5,7,13-14H,2-3,6,8H2,1H3,(H,20,21)/t13-,14-/m0/s1 |
| InChIKey | SHNZTHTUVGCWBU-KBPBESRZSA-N |
| XLogP | 2.08 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |