C26H38N8O4 — CID 67988955
1-[3-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]-2-methylpropyl]-3-(4-tert-butylphenyl)urea (PubChem CID 67988955) has the molecular formula C26H38N8O4 and a molecular weight of 526.64 g/mol. Its IUPAC name is 1-[3-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]-2-methylpropyl]-3-(4-tert-butylphenyl)urea.
| Compound Name | 1-[3-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]-2-methylpropyl]-3-(4-tert-butylphenyl)urea |
|---|---|
| PubChem CID | 67988955 |
| Molecular Formula | C26H38N8O4 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.30 |
| IUPAC Name | 1-[3-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]-2-methylpropyl]-3-(4-tert-butylphenyl)urea |
| SMILES | CC(CNC(=O)Nc1ccc(C(C)(C)C)cc1)CN(C)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C26H38N8O4/c1-15(10-28-25(37)32-17-8-6-16(7-9-17)26(2,3)4)11-33(5)12-18-20(35)21(36)24(38-18)34-14-31-19-22(27)29-13-30-23(19)34/h6-9,13-15,18,20-21,24,35-36H,10-12H2,1-5H3,(H2,27,29,30)(H2,28,32,37)/t15?,18-,20-,21-,24-/m1/s1 |
| InChIKey | PFYPVZCYAJWGGR-QRQSEGCHSA-N |
| XLogP | 1.71 |
| TPSA | 163.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |