C31H46O8 — CID 67989627
(1-oxo-1-propan-2-yloxypropan-2-yl) (1R)-4-deca-1,5,9-trienyl-2-ethenyl-1-[2-(2-methylpropanoyloxy)propanoyloxy]cyclopentane-1-carboxylate (PubChem CID 67989627) has the molecular formula C31H46O8 and a molecular weight of 546.70 g/mol. Its IUPAC name is (1-oxo-1-propan-2-yloxypropan-2-yl) (1R)-4-deca-1,5,9-trienyl-2-ethenyl-1-[2-(2-methylpropanoyloxy)propanoyloxy]cyclopentane-1-carboxylate.
| Compound Name | (1-oxo-1-propan-2-yloxypropan-2-yl) (1R)-4-deca-1,5,9-trienyl-2-ethenyl-1-[2-(2-methylpropanoyloxy)propanoyloxy]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 67989627 |
| Molecular Formula | C31H46O8 |
| Molecular Weight | 546.70 g/mol |
| Exact Mass | 546.32 |
| IUPAC Name | (1-oxo-1-propan-2-yloxypropan-2-yl) (1R)-4-deca-1,5,9-trienyl-2-ethenyl-1-[2-(2-methylpropanoyloxy)propanoyloxy]cyclopentane-1-carboxylate |
| SMILES | C=CCCC=CCCC=CC1CC(C=C)[C@@](OC(=O)C(C)OC(=O)C(C)C)(C(=O)OC(C)C(=O)OC(C)C)C1 |
| InChI | InChI=1S/C31H46O8/c1-9-11-12-13-14-15-16-17-18-25-19-26(10-2)31(20-25,30(35)38-23(7)28(33)36-22(5)6)39-29(34)24(8)37-27(32)21(3)4/h9-10,13-14,17-18,21-26H,1-2,11-12,15-16,19-20H2,3-8H3/t23?,24?,25?,26?,31-/m1/s1 |
| InChIKey | ODRPCNYDPOQQLY-NFZYZJDSSA-N |
| XLogP | 5.81 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.70 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|