C33H25N3O4S2 — CID 67989630
5,8-bis(7-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3-diphenylpyrido[3,4-b]pyrazine (PubChem CID 67989630) has the molecular formula C33H25N3O4S2 and a molecular weight of 591.71 g/mol. Its IUPAC name is 5,8-bis(7-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3-diphenylpyrido[3,4-b]pyrazine.
| Compound Name | 5,8-bis(7-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3-diphenylpyrido[3,4-b]pyrazine |
|---|---|
| PubChem CID | 67989630 |
| Molecular Formula | C33H25N3O4S2 |
| Molecular Weight | 591.71 g/mol |
| Exact Mass | 591.13 |
| IUPAC Name | 5,8-bis(7-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3-diphenylpyrido[3,4-b]pyrazine |
| SMILES | Cc1sc(-c2cnc(-c3sc(C)c4c3OCCO4)c3nc(-c4ccccc4)c(-c4ccccc4)nc23)c2c1OCCO2 |
| InChI | InChI=1S/C33H25N3O4S2/c1-18-28-30(39-15-13-37-28)32(41-18)22-17-34-27(33-31-29(19(2)42-33)38-14-16-40-31)26-25(22)35-23(20-9-5-3-6-10-20)24(36-26)21-11-7-4-8-12-21/h3-12,17H,13-16H2,1-2H3 |
| InChIKey | MXPBEYROKJUMEV-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 75.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.71 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |