C20H23N5O2 — CID 67989819
N'-[6-(3,4-dimethoxyphenyl)pyrido[2,3-b]pyrazin-3-yl]-2,2-dimethylpropanimidamide (PubChem CID 67989819) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is N'-[6-(3,4-dimethoxyphenyl)pyrido[2,3-b]pyrazin-3-yl]-2,2-dimethylpropanimidamide.
| Compound Name | N'-[6-(3,4-dimethoxyphenyl)pyrido[2,3-b]pyrazin-3-yl]-2,2-dimethylpropanimidamide |
|---|---|
| PubChem CID | 67989819 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | N'-[6-(3,4-dimethoxyphenyl)pyrido[2,3-b]pyrazin-3-yl]-2,2-dimethylpropanimidamide |
| SMILES | COc1ccc(-c2ccc3ncc(N=C(N)C(C)(C)C)nc3n2)cc1OC |
| InChI | InChI=1S/C20H23N5O2/c1-20(2,3)19(21)25-17-11-22-14-8-7-13(23-18(14)24-17)12-6-9-15(26-4)16(10-12)27-5/h6-11H,1-5H3,(H2,21,23,24,25) |
| InChIKey | QHFAFXRBTWKFIV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 95.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|