C22H26FN3O3 — CID 67990210
tert-butyl 4-[5-(2-fluoro-4-pyridinyl)-2,3-dihydrofuro[2,3-c]pyridin-2-yl]piperidine-1-carboxylate (PubChem CID 67990210) has the molecular formula C22H26FN3O3 and a molecular weight of 399.47 g/mol. Its IUPAC name is tert-butyl 4-[5-(2-fluoro-4-pyridinyl)-2,3-dihydrofuro[2,3-c]pyridin-2-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-(2-fluoro-4-pyridinyl)-2,3-dihydrofuro[2,3-c]pyridin-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67990210 |
| Molecular Formula | C22H26FN3O3 |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | tert-butyl 4-[5-(2-fluoro-4-pyridinyl)-2,3-dihydrofuro[2,3-c]pyridin-2-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C2Cc3cc(-c4ccnc(F)c4)ncc3O2)CC1 |
| InChI | InChI=1S/C22H26FN3O3/c1-22(2,3)29-21(27)26-8-5-14(6-9-26)18-11-16-10-17(25-13-19(16)28-18)15-4-7-24-20(23)12-15/h4,7,10,12-14,18H,5-6,8-9,11H2,1-3H3 |
| InChIKey | TXMVJKDMNJFCNK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|