C23H28FN3O3 — CID 67990243
tert-butyl 4-[5-(4-amino-2-fluorophenyl)-2,3-dihydrofuro[2,3-c]pyridin-2-yl]piperidine-1-carboxylate (PubChem CID 67990243) has the molecular formula C23H28FN3O3 and a molecular weight of 413.49 g/mol. Its IUPAC name is tert-butyl 4-[5-(4-amino-2-fluorophenyl)-2,3-dihydrofuro[2,3-c]pyridin-2-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-(4-amino-2-fluorophenyl)-2,3-dihydrofuro[2,3-c]pyridin-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67990243 |
| Molecular Formula | C23H28FN3O3 |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | tert-butyl 4-[5-(4-amino-2-fluorophenyl)-2,3-dihydrofuro[2,3-c]pyridin-2-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C2Cc3cc(-c4ccc(N)cc4F)ncc3O2)CC1 |
| InChI | InChI=1S/C23H28FN3O3/c1-23(2,3)30-22(28)27-8-6-14(7-9-27)20-11-15-10-19(26-13-21(15)29-20)17-5-4-16(25)12-18(17)24/h4-5,10,12-14,20H,6-9,11,25H2,1-3H3 |
| InChIKey | XKJLWTYUQLOMDS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|