C21H20FN3O — CID 67990334
(5aS,6S,9aR)-3-(2-fluorophenyl)-2,6,9a-trimethyl-7-oxo-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile (PubChem CID 67990334) has the molecular formula C21H20FN3O and a molecular weight of 349.41 g/mol. Its IUPAC name is (5aS,6S,9aR)-3-(2-fluorophenyl)-2,6,9a-trimethyl-7-oxo-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile.
| Compound Name | (5aS,6S,9aR)-3-(2-fluorophenyl)-2,6,9a-trimethyl-7-oxo-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile |
|---|---|
| PubChem CID | 67990334 |
| Molecular Formula | C21H20FN3O |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | (5aS,6S,9aR)-3-(2-fluorophenyl)-2,6,9a-trimethyl-7-oxo-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile |
| SMILES | C[C@@H]1C(=O)C(C#N)=C[C@]2(C)c3nn(C)c(-c4ccccc4F)c3CC[C@@H]12 |
| InChI | InChI=1S/C21H20FN3O/c1-12-16-9-8-15-18(14-6-4-5-7-17(14)22)25(3)24-20(15)21(16,2)10-13(11-23)19(12)26/h4-7,10,12,16H,8-9H2,1-3H3/t12-,16-,21-/m0/s1 |
| InChIKey | VWLILTVKTKQXKU-SAZGQGMLSA-N |
| XLogP | 3.72 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |