C14H22O3 — CID 67990394
(1S,7aS)-1-(methoxymethoxy)-4,4,7a-trimethyl-1,2,6,7-tetrahydroinden-5-one (PubChem CID 67990394) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is (1S,7aS)-1-(methoxymethoxy)-4,4,7a-trimethyl-1,2,6,7-tetrahydroinden-5-one.
| Compound Name | (1S,7aS)-1-(methoxymethoxy)-4,4,7a-trimethyl-1,2,6,7-tetrahydroinden-5-one |
|---|---|
| PubChem CID | 67990394 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | (1S,7aS)-1-(methoxymethoxy)-4,4,7a-trimethyl-1,2,6,7-tetrahydroinden-5-one |
| SMILES | COCO[C@H]1CC=C2C(C)(C)C(=O)CC[C@@]21C |
| InChI | InChI=1S/C14H22O3/c1-13(2)10-5-6-12(17-9-16-4)14(10,3)8-7-11(13)15/h5,12H,6-9H2,1-4H3/t12-,14-/m0/s1 |
| InChIKey | VEOFZHLPBUXMII-JSGCOSHPSA-N |
| XLogP | 2.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|