C19H38N2 — CID 67990591
N-cyclooctyl-N'-(3-ethyl-2-methylcyclohexyl)ethane-1,2-diamine (PubChem CID 67990591) has the molecular formula C19H38N2 and a molecular weight of 294.53 g/mol. Its IUPAC name is N-cyclooctyl-N'-(3-ethyl-2-methylcyclohexyl)ethane-1,2-diamine.
| Compound Name | N-cyclooctyl-N'-(3-ethyl-2-methylcyclohexyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 67990591 |
| Molecular Formula | C19H38N2 |
| Molecular Weight | 294.53 g/mol |
| Exact Mass | 294.30 |
| IUPAC Name | N-cyclooctyl-N'-(3-ethyl-2-methylcyclohexyl)ethane-1,2-diamine |
| SMILES | CCC1CCCC(NCCNC2CCCCCCC2)C1C |
| InChI | InChI=1S/C19H38N2/c1-3-17-10-9-13-19(16(17)2)21-15-14-20-18-11-7-5-4-6-8-12-18/h16-21H,3-15H2,1-2H3 |
| InChIKey | MEPRKTDMLAPJST-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|