C39H38B2N2O4 — CID 67990661
2-[4-[2-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-5-(4-pyridin-2-ylphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]pyridine (PubChem CID 67990661) has the molecular formula C39H38B2N2O4 and a molecular weight of 620.37 g/mol. Its IUPAC name is 2-[4-[2-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-5-(4-pyridin-2-ylphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]pyridine.
| Compound Name | 2-[4-[2-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-5-(4-pyridin-2-ylphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]pyridine |
|---|---|
| PubChem CID | 67990661 |
| Molecular Formula | C39H38B2N2O4 |
| Molecular Weight | 620.37 g/mol |
| Exact Mass | 620.30 |
| IUPAC Name | 2-[4-[2-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-5-(4-pyridin-2-ylphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]pyridine |
| SMILES | C=C1OB(c2cc(B3OC(C)(C)C(C)(C)O3)c(-c3ccc(-c4ccccn4)cc3)cc2-c2ccc(-c3ccccn3)cc2)OC1(C)C |
| InChI | InChI=1S/C39H38B2N2O4/c1-26-37(2,3)45-40(44-26)33-25-34(41-46-38(4,5)39(6,7)47-41)32(28-16-20-30(21-17-28)36-13-9-11-23-43-36)24-31(33)27-14-18-29(19-15-27)35-12-8-10-22-42-35/h8-25H,1H2,2-7H3 |
| InChIKey | PQKULXAAROGKQA-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.37 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|