C32H36N6O3 — CID 67990719
tert-butyl N-[(Z)-5-[[3-[4-(cyclopropylcarbamoyl)phenyl]-6-phenylimidazo[1,2-a]pyrazin-8-yl]amino]pent-2-enyl]carbamate (PubChem CID 67990719) has the molecular formula C32H36N6O3 and a molecular weight of 552.68 g/mol. Its IUPAC name is tert-butyl N-[(Z)-5-[[3-[4-(cyclopropylcarbamoyl)phenyl]-6-phenylimidazo[1,2-a]pyrazin-8-yl]amino]pent-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(Z)-5-[[3-[4-(cyclopropylcarbamoyl)phenyl]-6-phenylimidazo[1,2-a]pyrazin-8-yl]amino]pent-2-enyl]carbamate |
|---|---|
| PubChem CID | 67990719 |
| Molecular Formula | C32H36N6O3 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.28 |
| IUPAC Name | tert-butyl N-[(Z)-5-[[3-[4-(cyclopropylcarbamoyl)phenyl]-6-phenylimidazo[1,2-a]pyrazin-8-yl]amino]pent-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC/C=C\CCNc1nc(-c2ccccc2)cn2c(-c3ccc(C(=O)NC4CC4)cc3)cnc12 |
| InChI | InChI=1S/C32H36N6O3/c1-32(2,3)41-31(40)34-19-9-5-8-18-33-28-29-35-20-27(38(29)21-26(37-28)22-10-6-4-7-11-22)23-12-14-24(15-13-23)30(39)36-25-16-17-25/h4-7,9-15,20-21,25H,8,16-19H2,1-3H3,(H,33,37)(H,34,40)(H,36,39)/b9-5- |
| InChIKey | PDLZTGZLNVDBSL-UITAMQMPSA-N |
| XLogP | 5.84 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|