About 7-fluoro-4,6-dimethylquinazoline
7-fluoro-4,6-dimethylquinazoline (PubChem CID 67990851) has the molecular formula C10H9FN2
and a molecular weight of 176.19 g/mol. Its IUPAC name is 7-fluoro-4,6-dimethylquinazoline.
Molecular Properties
| Compound Name | 7-fluoro-4,6-dimethylquinazoline |
| PubChem CID | 67990851 |
| Molecular Formula | C10H9FN2 |
| Molecular Weight | 176.19 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 7-fluoro-4,6-dimethylquinazoline |
| SMILES | Cc1cc2c(C)ncnc2cc1F |
| InChI | InChI=1S/C10H9FN2/c1-6-3-8-7(2)12-5-13-10(8)4-9(6)11/h3-5H,1-2H3 |
| InChIKey | GHEIELFKUPEKTP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.19 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-fluoro-4,6-dimethylquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-4,6-dimethylquinazoline?
The IUPAC name of 7-fluoro-4,6-dimethylquinazoline (CID 67990851) is 7-fluoro-4,6-dimethylquinazoline.
What is the SMILES notation for 7-fluoro-4,6-dimethylquinazoline?
The canonical SMILES for 7-fluoro-4,6-dimethylquinazoline is Cc1cc2c(C)ncnc2cc1F.
What is the InChIKey of 7-fluoro-4,6-dimethylquinazoline?
The InChIKey is GHEIELFKUPEKTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FN2/c1-6-3-8-7(2)12-5-13-10(8)4-9(6)11/h3-5H,1-2H3.
What are the key properties of 7-fluoro-4,6-dimethylquinazoline?
7-fluoro-4,6-dimethylquinazoline has a molecular weight of 176.19 g/mol, XLogP of 2.39, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-4,6-dimethylquinazoline is sourced from PubChem (CID 67990851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).