C16H16Cl3NO4 — CID 67990859
[(4R,6R)-2,2-dimethyl-4-(2,5,6-trichloroindol-1-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol (PubChem CID 67990859) has the molecular formula C16H16Cl3NO4 and a molecular weight of 392.67 g/mol. Its IUPAC name is [(4R,6R)-2,2-dimethyl-4-(2,5,6-trichloroindol-1-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol.
| Compound Name | [(4R,6R)-2,2-dimethyl-4-(2,5,6-trichloroindol-1-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol |
|---|---|
| PubChem CID | 67990859 |
| Molecular Formula | C16H16Cl3NO4 |
| Molecular Weight | 392.67 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | [(4R,6R)-2,2-dimethyl-4-(2,5,6-trichloroindol-1-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol |
| SMILES | CC1(C)OC2C(O1)[C@@H](CO)O[C@H]2n1c(Cl)cc2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C16H16Cl3NO4/c1-16(2)23-13-11(6-21)22-15(14(13)24-16)20-10-5-9(18)8(17)3-7(10)4-12(20)19/h3-5,11,13-15,21H,6H2,1-2H3/t11-,13?,14?,15-/m1/s1 |
| InChIKey | IINZOESFEJDPEY-GALLPEHLSA-N |
| XLogP | 4.01 |
| TPSA | 52.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.67 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |