About 3-[5-[(2,5-dimethylphenyl)methyl]thiophen-2-yl]phenol
3-[5-[(2,5-dimethylphenyl)methyl]thiophen-2-yl]phenol (PubChem CID 67990916) has the molecular formula C19H18OS
and a molecular weight of 294.42 g/mol. Its IUPAC name is 3-[5-[(2,5-dimethylphenyl)methyl]thiophen-2-yl]phenol.
Molecular Properties
| Compound Name | 3-[5-[(2,5-dimethylphenyl)methyl]thiophen-2-yl]phenol |
| PubChem CID | 67990916 |
| Molecular Formula | C19H18OS |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 3-[5-[(2,5-dimethylphenyl)methyl]thiophen-2-yl]phenol |
| SMILES | Cc1ccc(C)c(Cc2ccc(-c3cccc(O)c3)s2)c1 |
| InChI | InChI=1S/C19H18OS/c1-13-6-7-14(2)16(10-13)12-18-8-9-19(21-18)15-4-3-5-17(20)11-15/h3-11,20H,12H2,1-2H3 |
| InChIKey | VLYKQXNBQSUHFW-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[5-[(2,5-dimethylphenyl)methyl]thiophen-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-[(2,5-dimethylphenyl)methyl]thiophen-2-yl]phenol?
The IUPAC name of 3-[5-[(2,5-dimethylphenyl)methyl]thiophen-2-yl]phenol (CID 67990916) is 3-[5-[(2,5-dimethylphenyl)methyl]thiophen-2-yl]phenol.
What is the SMILES notation for 3-[5-[(2,5-dimethylphenyl)methyl]thiophen-2-yl]phenol?
The canonical SMILES for 3-[5-[(2,5-dimethylphenyl)methyl]thiophen-2-yl]phenol is Cc1ccc(C)c(Cc2ccc(-c3cccc(O)c3)s2)c1.
What is the InChIKey of 3-[5-[(2,5-dimethylphenyl)methyl]thiophen-2-yl]phenol?
The InChIKey is VLYKQXNBQSUHFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18OS/c1-13-6-7-14(2)16(10-13)12-18-8-9-19(21-18)15-4-3-5-17(20)11-15/h3-11,20H,12H2,1-2H3.
What are the key properties of 3-[5-[(2,5-dimethylphenyl)methyl]thiophen-2-yl]phenol?
3-[5-[(2,5-dimethylphenyl)methyl]thiophen-2-yl]phenol has a molecular weight of 294.42 g/mol, XLogP of 5.33, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-[(2,5-dimethylphenyl)methyl]thiophen-2-yl]phenol is sourced from PubChem (CID 67990916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).