C12H14N2O — CID 67991214
8-methoxy-N,N-dimethylquinolin-5-amine (PubChem CID 67991214) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 8-methoxy-N,N-dimethylquinolin-5-amine.
| Compound Name | 8-methoxy-N,N-dimethylquinolin-5-amine |
|---|---|
| PubChem CID | 67991214 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 8-methoxy-N,N-dimethylquinolin-5-amine |
| SMILES | COc1ccc(N(C)C)c2cccnc12 |
| InChI | InChI=1S/C12H14N2O/c1-14(2)10-6-7-11(15-3)12-9(10)5-4-8-13-12/h4-8H,1-3H3 |
| InChIKey | NNBQMJZBLLABQZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|