C9H6F4N2 — CID 67991292
2,2,5,6-tetrafluoro-4,7-dimethylbenzimidazole (PubChem CID 67991292) has the molecular formula C9H6F4N2 and a molecular weight of 218.15 g/mol. Its IUPAC name is 2,2,5,6-tetrafluoro-4,7-dimethylbenzimidazole.
| Compound Name | 2,2,5,6-tetrafluoro-4,7-dimethylbenzimidazole |
|---|---|
| PubChem CID | 67991292 |
| Molecular Formula | C9H6F4N2 |
| Molecular Weight | 218.15 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 2,2,5,6-tetrafluoro-4,7-dimethylbenzimidazole |
| SMILES | Cc1c(F)c(F)c(C)c2c1=NC(F)(F)N=2 |
| InChI | InChI=1S/C9H6F4N2/c1-3-5(10)6(11)4(2)8-7(3)14-9(12,13)15-8/h1-2H3 |
| InChIKey | ZMZIIZOLWSFHPW-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.15 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|